C56H108N2O5 — CID 164814022
diundecan-5-yl 10-[octanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate (PubChem CID 164814022) has the molecular formula C56H108N2O5 and a molecular weight of 889.49 g/mol. Its IUPAC name is diundecan-5-yl 10-[octanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate.
| Compound Name | diundecan-5-yl 10-[octanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
|---|---|
| PubChem CID | 164814022 |
| Molecular Formula | C56H108N2O5 |
| Molecular Weight | 889.49 g/mol |
| Exact Mass | 888.83 |
| IUPAC Name | diundecan-5-yl 10-[octanoyl(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
| SMILES | CCCCCCCC(=O)N(CCCN1CCCC1)C(CCCCCCCCC(=O)OC(CCCC)CCCCCC)CCCCCCCCC(=O)OC(CCCC)CCCCCC |
| InChI | InChI=1S/C56H108N2O5/c1-6-11-16-23-32-44-54(59)58(50-37-49-57-47-35-36-48-57)51(38-28-24-19-21-26-33-45-55(60)62-52(40-14-9-4)42-30-17-12-7-2)39-29-25-20-22-27-34-46-56(61)63-53(41-15-10-5)43-31-18-13-8-3/h51-53H,6-50H2,1-5H3 |
| InChIKey | SIGIMZUMSSPVCL-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.49 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|