C60H116N2O4S2 — CID 171659041
ditridecan-7-yl 10-[4-(butyldisulfanyl)but-1-en-2-yl-(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate (PubChem CID 171659041) has the molecular formula C60H116N2O4S2 and a molecular weight of 993.73 g/mol. Its IUPAC name is ditridecan-7-yl 10-[4-(butyldisulfanyl)but-1-en-2-yl-(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate.
| Compound Name | ditridecan-7-yl 10-[4-(butyldisulfanyl)but-1-en-2-yl-(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
|---|---|
| PubChem CID | 171659041 |
| Molecular Formula | C60H116N2O4S2 |
| Molecular Weight | 993.73 g/mol |
| Exact Mass | 992.84 |
| IUPAC Name | ditridecan-7-yl 10-[4-(butyldisulfanyl)but-1-en-2-yl-(3-pyrrolidin-1-ylpropyl)amino]nonadecanedioate |
| SMILES | C=C(CCSSCCCC)N(CCCN1CCCC1)C(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)CCCCCCCCC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C60H116N2O4S2/c1-7-12-17-31-42-57(43-32-18-13-8-2)65-59(63)46-35-27-23-21-25-29-40-56(62(52-39-51-61-49-37-38-50-61)55(6)48-54-68-67-53-16-11-5)41-30-26-22-24-28-36-47-60(64)66-58(44-33-19-14-9-3)45-34-20-15-10-4/h56-58H,6-54H2,1-5H3 |
| InChIKey | QPLMKRZAIOCWBD-UHFFFAOYSA-N |
| XLogP | 19.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.73 |
| LogP ≤ 5 | 19.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|