About bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate
bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate (PubChem CID 164730047) has the molecular formula C56H103NO6
and a molecular weight of 886.44 g/mol. Its IUPAC name is bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate.
Molecular Properties
| Compound Name | bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate |
| PubChem CID | 164730047 |
| Molecular Formula | C56H103NO6 |
| Molecular Weight | 886.44 g/mol |
| Exact Mass | 885.78 |
| IUPAC Name | bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate |
| SMILES | CCCCCC(=CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCC=C(CCCCC)CCCCC)OC(=O)CCCN1CCCCC1)CCCCC |
| InChI | InChI=1S/C56H103NO6/c1-5-9-24-35-51(36-25-10-6-2)44-49-61-54(58)41-30-21-17-13-15-19-28-39-53(63-56(60)43-34-48-57-46-32-23-33-47-57)40-29-20-16-14-18-22-31-42-55(59)62-50-45-52(37-26-11-7-3)38-27-12-8-4/h44-45,53H,5-43,46-50H2,1-4H3 |
| InChIKey | PVUQZUGPNLHXEH-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 886.44 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate?
The IUPAC name of bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate (CID 164730047) is bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate.
What is the SMILES notation for bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate?
The canonical SMILES for bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate is CCCCCC(=CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCC=C(CCCCC)CCCCC)OC(=O)CCCN1CCCCC1)CCCCC.
What is the InChIKey of bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate?
The InChIKey is PVUQZUGPNLHXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H103NO6/c1-5-9-24-35-51(36-25-10-6-2)44-49-61-54(58)41-30-21-17-13-15-19-28-39-53(63-56(60)43-34-48-57-46-32-23-33-47-57)40-29-20-16-14-18-22-31-42-55(59)62-50-45-52(37-26-11-7-3)38-27-12-8-4/h44-45,53H,5-43,46-50H2,1-4H3.
What are the key properties of bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate?
bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate has a molecular weight of 886.44 g/mol, XLogP of 16.45, 45 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-pentyloct-2-enyl) 11-(4-piperidin-1-ylbutanoyloxy)henicosanedioate is sourced from PubChem (CID 164730047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).