C42H76N2O6 — CID 166831602
bis[(Z)-non-2-enyl] 9-(4-imidazolidin-1-ylbutanoyloxy)heptadecanedioate (PubChem CID 166831602) has the molecular formula C42H76N2O6 and a molecular weight of 705.08 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 9-(4-imidazolidin-1-ylbutanoyloxy)heptadecanedioate.
| Compound Name | bis[(Z)-non-2-enyl] 9-(4-imidazolidin-1-ylbutanoyloxy)heptadecanedioate |
|---|---|
| PubChem CID | 166831602 |
| Molecular Formula | C42H76N2O6 |
| Molecular Weight | 705.08 g/mol |
| Exact Mass | 704.57 |
| IUPAC Name | bis[(Z)-non-2-enyl] 9-(4-imidazolidin-1-ylbutanoyloxy)heptadecanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C\CCCCCC)OC(=O)CCCN1CCNC1 |
| InChI | InChI=1S/C42H76N2O6/c1-3-5-7-9-11-19-25-36-48-40(45)30-23-17-13-15-21-28-39(50-42(47)32-27-34-44-35-33-43-38-44)29-22-16-14-18-24-31-41(46)49-37-26-20-12-10-8-6-4-2/h19-20,25-26,39,43H,3-18,21-24,27-38H2,1-2H3/b25-19-,26-20- |
| InChIKey | CREWCNNPXDUTGP-DQIQZUARSA-N |
| XLogP | 10.14 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.08 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|