C43H81N3O4 — CID 156544711
bis[(E)-non-2-enyl] 9-[4-(3-methyl-1,3,5-triazinan-1-yl)butyl]heptadecanedioate (PubChem CID 156544711) has the molecular formula C43H81N3O4 and a molecular weight of 704.14 g/mol. Its IUPAC name is bis[(E)-non-2-enyl] 9-[4-(3-methyl-1,3,5-triazinan-1-yl)butyl]heptadecanedioate.
| Compound Name | bis[(E)-non-2-enyl] 9-[4-(3-methyl-1,3,5-triazinan-1-yl)butyl]heptadecanedioate |
|---|---|
| PubChem CID | 156544711 |
| Molecular Formula | C43H81N3O4 |
| Molecular Weight | 704.14 g/mol |
| Exact Mass | 703.62 |
| IUPAC Name | bis[(E)-non-2-enyl] 9-[4-(3-methyl-1,3,5-triazinan-1-yl)butyl]heptadecanedioate |
| SMILES | CCCCCC/C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C/CCCCCC)CCCCN1CNCN(C)C1 |
| InChI | InChI=1S/C43H81N3O4/c1-4-6-8-10-12-20-28-36-49-42(47)33-24-18-14-16-22-30-41(32-26-27-35-46-39-44-38-45(3)40-46)31-23-17-15-19-25-34-43(48)50-37-29-21-13-11-9-7-5-2/h20-21,28-29,41,44H,4-19,22-27,30-40H2,1-3H3/b28-20+,29-21+ |
| InChIKey | HKMXESQUURTDOT-IABPKXMJSA-N |
| XLogP | 11.08 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.14 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|