About [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate
[(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate (PubChem CID 169098024) has the molecular formula C30H56O3
and a molecular weight of 464.78 g/mol. Its IUPAC name is [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate.
Molecular Properties
| Compound Name | [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate |
| PubChem CID | 169098024 |
| Molecular Formula | C30H56O3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.42 |
| IUPAC Name | [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate |
| SMILES | CCCCCCCC/C=C\COC(=O)CCCCCCC(CC=O)CCCCCCCCC |
| InChI | InChI=1S/C30H56O3/c1-3-5-7-9-11-12-14-18-22-28-33-30(32)25-21-17-16-20-24-29(26-27-31)23-19-15-13-10-8-6-4-2/h18,22,27,29H,3-17,19-21,23-26,28H2,1-2H3/b22-18- |
| InChIKey | PBFZZZOOMNAPJN-PYCFMQQDSA-N |
| XLogP | 9.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate?
The IUPAC name of [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate (CID 169098024) is [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate.
What is the SMILES notation for [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate?
The canonical SMILES for [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate is CCCCCCCC/C=C\COC(=O)CCCCCCC(CC=O)CCCCCCCCC.
What is the InChIKey of [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate?
The InChIKey is PBFZZZOOMNAPJN-PYCFMQQDSA-N. The full InChI is InChI=1S/C30H56O3/c1-3-5-7-9-11-12-14-18-22-28-33-30(32)25-21-17-16-20-24-29(26-27-31)23-19-15-13-10-8-6-4-2/h18,22,27,29H,3-17,19-21,23-26,28H2,1-2H3/b22-18-.
What are the key properties of [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate?
[(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate has a molecular weight of 464.78 g/mol, XLogP of 9.52, 26 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-undec-2-enyl] 8-(2-oxoethyl)heptadecanoate is sourced from PubChem (CID 169098024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).