C41H74N2O6 — CID 123953777
bis(non-2-enyl) 9-[3-[aziridin-1-yl(methyl)amino]propanoyloxy]heptadecanedioate (PubChem CID 123953777) has the molecular formula C41H74N2O6 and a molecular weight of 691.05 g/mol. Its IUPAC name is bis(non-2-enyl) 9-[3-[aziridin-1-yl(methyl)amino]propanoyloxy]heptadecanedioate.
| Compound Name | bis(non-2-enyl) 9-[3-[aziridin-1-yl(methyl)amino]propanoyloxy]heptadecanedioate |
|---|---|
| PubChem CID | 123953777 |
| Molecular Formula | C41H74N2O6 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.55 |
| IUPAC Name | bis(non-2-enyl) 9-[3-[aziridin-1-yl(methyl)amino]propanoyloxy]heptadecanedioate |
| SMILES | CCCCCCC=CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCC=CCCCCCC)OC(=O)CCN(C)N1CC1 |
| InChI | InChI=1S/C41H74N2O6/c1-4-6-8-10-12-20-26-36-47-39(44)30-24-18-14-16-22-28-38(49-41(46)32-33-42(3)43-34-35-43)29-23-17-15-19-25-31-40(45)48-37-27-21-13-11-9-7-5-2/h20-21,26-27,38H,4-19,22-25,28-37H2,1-3H3 |
| InChIKey | ATXNDKSVOPFESJ-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|