C51H96N2O9 — CID 177227039
[3-acetyloxy-2-[(4-decan-4-yloxy-4-oxobutanoyl)-(3-pyrrolidin-1-ylpropyl)amino]propyl] 5,5-didecoxypentanoate (PubChem CID 177227039) has the molecular formula C51H96N2O9 and a molecular weight of 881.33 g/mol. Its IUPAC name is [3-acetyloxy-2-[(4-decan-4-yloxy-4-oxobutanoyl)-(3-pyrrolidin-1-ylpropyl)amino]propyl] 5,5-didecoxypentanoate.
| Compound Name | [3-acetyloxy-2-[(4-decan-4-yloxy-4-oxobutanoyl)-(3-pyrrolidin-1-ylpropyl)amino]propyl] 5,5-didecoxypentanoate |
|---|---|
| PubChem CID | 177227039 |
| Molecular Formula | C51H96N2O9 |
| Molecular Weight | 881.33 g/mol |
| Exact Mass | 880.71 |
| IUPAC Name | [3-acetyloxy-2-[(4-decan-4-yloxy-4-oxobutanoyl)-(3-pyrrolidin-1-ylpropyl)amino]propyl] 5,5-didecoxypentanoate |
| SMILES | CCCCCCCCCCOC(CCCC(=O)OCC(COC(C)=O)N(CCCN1CCCC1)C(=O)CCC(=O)OC(CCC)CCCCCC)OCCCCCCCCCC |
| InChI | InChI=1S/C51H96N2O9/c1-6-10-13-16-18-20-22-27-41-58-51(59-42-28-23-21-19-17-14-11-7-2)34-29-33-49(56)61-44-46(43-60-45(5)54)53(40-30-39-52-37-25-26-38-52)48(55)35-36-50(57)62-47(31-9-4)32-24-15-12-8-3/h46-47,51H,6-44H2,1-5H3 |
| InChIKey | CZHULCMHJCHRRL-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.33 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|