C62H116N2O11 — CID 170657171
10-O-decan-4-yl 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(10-decan-4-yloxy-10-oxodecanoyl)oxypropyl] decanedioate (PubChem CID 170657171) has the molecular formula C62H116N2O11 and a molecular weight of 1065.61 g/mol. Its IUPAC name is 10-O-decan-4-yl 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(10-decan-4-yloxy-10-oxodecanoyl)oxypropyl] decanedioate.
| Compound Name | 10-O-decan-4-yl 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(10-decan-4-yloxy-10-oxodecanoyl)oxypropyl] decanedioate |
|---|---|
| PubChem CID | 170657171 |
| Molecular Formula | C62H116N2O11 |
| Molecular Weight | 1065.61 g/mol |
| Exact Mass | 1064.86 |
| IUPAC Name | 10-O-decan-4-yl 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(10-decan-4-yloxy-10-oxodecanoyl)oxypropyl] decanedioate |
| SMILES | CCCCCCC(CCC)OC(=O)CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(=O)OC(CCC)CCCCCC)N(CCCN(C)C)C(=O)CCC(=O)OC(CCC)CCCCCC |
| InChI | InChI=1S/C62H116N2O11/c1-9-15-18-29-40-54(37-12-4)73-60(68)45-34-27-23-21-25-32-43-58(66)71-51-53(64(50-36-49-63(7)8)57(65)47-48-62(70)75-56(39-14-6)42-31-20-17-11-3)52-72-59(67)44-33-26-22-24-28-35-46-61(69)74-55(38-13-5)41-30-19-16-10-2/h53-56H,9-52H2,1-8H3 |
| InChIKey | CBZBLQOHLXORKI-UHFFFAOYSA-N |
| XLogP | 15.29 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.61 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|