C59H116N2O5 — CID 146326022
1-O-tetradecan-7-yl 19-O-tridecan-7-yl 10-[3-(dimethylamino)propyl-octanoylamino]nonadecanedioate (PubChem CID 146326022) has the molecular formula C59H116N2O5 and a molecular weight of 933.59 g/mol. Its IUPAC name is 1-O-tetradecan-7-yl 19-O-tridecan-7-yl 10-[3-(dimethylamino)propyl-octanoylamino]nonadecanedioate.
| Compound Name | 1-O-tetradecan-7-yl 19-O-tridecan-7-yl 10-[3-(dimethylamino)propyl-octanoylamino]nonadecanedioate |
|---|---|
| PubChem CID | 146326022 |
| Molecular Formula | C59H116N2O5 |
| Molecular Weight | 933.59 g/mol |
| Exact Mass | 932.89 |
| IUPAC Name | 1-O-tetradecan-7-yl 19-O-tridecan-7-yl 10-[3-(dimethylamino)propyl-octanoylamino]nonadecanedioate |
| SMILES | CCCCCCCC(=O)N(CCCN(C)C)C(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)CCCCCCCCC(=O)OC(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C59H116N2O5/c1-8-13-18-27-38-48-56(47-37-22-17-12-5)66-59(64)51-41-32-26-24-30-34-44-54(61(53-42-52-60(6)7)57(62)49-39-28-19-14-9-2)43-33-29-23-25-31-40-50-58(63)65-55(45-35-20-15-10-3)46-36-21-16-11-4/h54-56H,8-53H2,1-7H3 |
| InChIKey | ZBRYIXBAYCZTQM-UHFFFAOYSA-N |
| XLogP | 17.83 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.59 |
| LogP ≤ 5 | 17.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|