C59H110N2O11 — CID 176802541
1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[4-(dimethylamino)butyl]amino]-3-(10-octan-3-yloxy-10-oxodecanoyl)oxypropyl] 10-O-octan-3-yl decanedioate (PubChem CID 176802541) has the molecular formula C59H110N2O11 and a molecular weight of 1023.53 g/mol. Its IUPAC name is 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[4-(dimethylamino)butyl]amino]-3-(10-octan-3-yloxy-10-oxodecanoyl)oxypropyl] 10-O-octan-3-yl decanedioate.
| Compound Name | 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[4-(dimethylamino)butyl]amino]-3-(10-octan-3-yloxy-10-oxodecanoyl)oxypropyl] 10-O-octan-3-yl decanedioate |
|---|---|
| PubChem CID | 176802541 |
| Molecular Formula | C59H110N2O11 |
| Molecular Weight | 1023.53 g/mol |
| Exact Mass | 1022.81 |
| IUPAC Name | 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[4-(dimethylamino)butyl]amino]-3-(10-octan-3-yloxy-10-oxodecanoyl)oxypropyl] 10-O-octan-3-yl decanedioate |
| SMILES | CCCCCCC(CCC)OC(=O)CCC(=O)N(CCCCN(C)C)C(COC(=O)CCCCCCCCC(=O)OC(CC)CCCCC)COC(=O)CCCCCCCCC(=O)OC(CC)CCCCC |
| InChI | InChI=1S/C59H110N2O11/c1-9-15-18-29-39-53(36-12-4)72-59(67)45-44-54(62)61(47-35-34-46-60(7)8)50(48-68-55(63)40-30-23-19-21-25-32-42-57(65)70-51(13-5)37-27-16-10-2)49-69-56(64)41-31-24-20-22-26-33-43-58(66)71-52(14-6)38-28-17-11-3/h50-53H,9-49H2,1-8H3 |
| InChIKey | DZVWMIFMKHZHFK-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.53 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|