C62H112N2O15 — CID 170618838
1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(4-decoxy-2-hexanoyloxy-4-oxobutanoyl)oxypropyl] 4-O-decyl 2-hexanoyloxybutanedioate (PubChem CID 170618838) has the molecular formula C62H112N2O15 and a molecular weight of 1125.58 g/mol. Its IUPAC name is 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(4-decoxy-2-hexanoyloxy-4-oxobutanoyl)oxypropyl] 4-O-decyl 2-hexanoyloxybutanedioate.
| Compound Name | 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(4-decoxy-2-hexanoyloxy-4-oxobutanoyl)oxypropyl] 4-O-decyl 2-hexanoyloxybutanedioate |
|---|---|
| PubChem CID | 170618838 |
| Molecular Formula | C62H112N2O15 |
| Molecular Weight | 1125.58 g/mol |
| Exact Mass | 1124.81 |
| IUPAC Name | 1-O-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(4-decoxy-2-hexanoyloxy-4-oxobutanoyl)oxypropyl] 4-O-decyl 2-hexanoyloxybutanedioate |
| SMILES | CCCCCCCCCCOC(=O)CC(OC(=O)CCCCC)C(=O)OCC(COC(=O)C(CC(=O)OCCCCCCCCCC)OC(=O)CCCCC)N(CCCN(C)C)C(=O)CCC(=O)OC(CCC)CCCCCC |
| InChI | InChI=1S/C62H112N2O15/c1-9-15-20-23-25-27-29-34-45-73-59(69)47-53(78-56(66)39-31-18-12-4)61(71)75-49-51(64(44-36-43-63(7)8)55(65)41-42-58(68)77-52(37-14-6)38-33-22-17-11-3)50-76-62(72)54(79-57(67)40-32-19-13-5)48-60(70)74-46-35-30-28-26-24-21-16-10-2/h51-54H,9-50H2,1-8H3 |
| InChIKey | KAFRFCJPMORVDD-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 207.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.58 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|