C35H74N2O5Si2 — CID 176802563
decan-4-yl 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl-[4-(dimethylamino)butyl]amino]-4-oxobutanoate (PubChem CID 176802563) has the molecular formula C35H74N2O5Si2 and a molecular weight of 659.16 g/mol. Its IUPAC name is decan-4-yl 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl-[4-(dimethylamino)butyl]amino]-4-oxobutanoate.
| Compound Name | decan-4-yl 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl-[4-(dimethylamino)butyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 176802563 |
| Molecular Formula | C35H74N2O5Si2 |
| Molecular Weight | 659.16 g/mol |
| Exact Mass | 658.51 |
| IUPAC Name | decan-4-yl 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl-[4-(dimethylamino)butyl]amino]-4-oxobutanoate |
| SMILES | CCCCCCC(CCC)OC(=O)CCC(=O)N(CCCCN(C)C)C(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H74N2O5Si2/c1-15-17-18-19-23-31(22-16-2)42-33(39)25-24-32(38)37(27-21-20-26-36(9)10)30(28-40-43(11,12)34(3,4)5)29-41-44(13,14)35(6,7)8/h30-31H,15-29H2,1-14H3 |
| InChIKey | CYNFGOFSPFYUOW-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.16 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|