C49H96F2N2O3 — CID 169107752
heptadecan-9-yl 7-[decyl-[4-(dimethylamino)butanoyl]amino]-2,2-difluorohexadecanoate (PubChem CID 169107752) has the molecular formula C49H96F2N2O3 and a molecular weight of 799.31 g/mol. Its IUPAC name is heptadecan-9-yl 7-[decyl-[4-(dimethylamino)butanoyl]amino]-2,2-difluorohexadecanoate.
| Compound Name | heptadecan-9-yl 7-[decyl-[4-(dimethylamino)butanoyl]amino]-2,2-difluorohexadecanoate |
|---|---|
| PubChem CID | 169107752 |
| Molecular Formula | C49H96F2N2O3 |
| Molecular Weight | 799.31 g/mol |
| Exact Mass | 798.74 |
| IUPAC Name | heptadecan-9-yl 7-[decyl-[4-(dimethylamino)butanoyl]amino]-2,2-difluorohexadecanoate |
| SMILES | CCCCCCCCCCN(C(=O)CCCN(C)C)C(CCCCCCCCC)CCCCC(F)(F)C(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C49H96F2N2O3/c1-7-11-15-19-23-25-29-35-44-53(47(54)41-36-43-52(5)6)45(37-30-26-24-20-16-12-8-2)38-33-34-42-49(50,51)48(55)56-46(39-31-27-21-17-13-9-3)40-32-28-22-18-14-10-4/h45-46H,7-44H2,1-6H3 |
| InChIKey | GLSOTUUYRAFBCH-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.31 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|