C27H54N2O3 — CID 169107453
3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid (PubChem CID 169107453) has the molecular formula C27H54N2O3 and a molecular weight of 454.74 g/mol. Its IUPAC name is 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid.
| Compound Name | 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid |
|---|---|
| PubChem CID | 169107453 |
| Molecular Formula | C27H54N2O3 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.41 |
| IUPAC Name | 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid |
| SMILES | CCCCCCCCCC(=O)N(CCCN(C)C)C(CCCCCCCCC)CC(=O)O |
| InChI | InChI=1S/C27H54N2O3/c1-5-7-9-11-13-15-17-20-25(24-27(31)32)29(23-19-22-28(3)4)26(30)21-18-16-14-12-10-8-6-2/h25H,5-24H2,1-4H3,(H,31,32) |
| InChIKey | QGZQKSGCPVGWQA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|