C55H110N4O6 — CID 175930970
3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid;methyl 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoate (PubChem CID 175930970) has the molecular formula C55H110N4O6 and a molecular weight of 923.51 g/mol. Its IUPAC name is 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid;methyl 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoate.
| Compound Name | 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid;methyl 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoate |
|---|---|
| PubChem CID | 175930970 |
| Molecular Formula | C55H110N4O6 |
| Molecular Weight | 923.51 g/mol |
| Exact Mass | 922.84 |
| IUPAC Name | 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoic acid;methyl 3-[decanoyl-[3-(dimethylamino)propyl]amino]dodecanoate |
| SMILES | CCCCCCCCCC(=O)N(CCCN(C)C)C(CCCCCCCCC)CC(=O)O.CCCCCCCCCC(=O)N(CCCN(C)C)C(CCCCCCCCC)CC(=O)OC |
| InChI | InChI=1S/C28H56N2O3.C27H54N2O3/c1-6-8-10-12-14-16-18-21-26(25-28(32)33-5)30(24-20-23-29(3)4)27(31)22-19-17-15-13-11-9-7-2;1-5-7-9-11-13-15-17-20-25(24-27(31)32)29(23-19-22-28(3)4)26(30)21-18-16-14-12-10-8-6-2/h26H,6-25H2,1-5H3;25H,5-24H2,1-4H3,(H,31,32) |
| InChIKey | IZCOAGBTANMMJT-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.51 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|