C44H82N4O6 — CID 175930960
methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecanoate (PubChem CID 175930960) has the molecular formula C44H82N4O6 and a molecular weight of 763.16 g/mol. Its IUPAC name is methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecanoate.
| Compound Name | methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecanoate |
|---|---|
| PubChem CID | 175930960 |
| Molecular Formula | C44H82N4O6 |
| Molecular Weight | 763.16 g/mol |
| Exact Mass | 762.62 |
| IUPAC Name | methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecanoate |
| SMILES | CCCCCCCCCC(CC(=O)OC)N(CCCN(C)C)C(=O)OCc1ccccc1.CCCCCCCCCC(CC(=O)OC)NCCCN(C)C |
| InChI | InChI=1S/C26H44N2O4.C18H38N2O2/c1-5-6-7-8-9-10-14-18-24(21-25(29)31-4)28(20-15-19-27(2)3)26(30)32-22-23-16-12-11-13-17-23;1-5-6-7-8-9-10-11-13-17(16-18(21)22-4)19-14-12-15-20(2)3/h11-13,16-17,24H,5-10,14-15,18-22H2,1-4H3;17,19H,5-16H2,1-4H3 |
| InChIKey | BLAIZQYWTPMVEE-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.16 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|