C36H74N2O2 — CID 171658653
2-butyloctyl 10-[3-(dimethylamino)propylamino]nonadecanoate (PubChem CID 171658653) has the molecular formula C36H74N2O2 and a molecular weight of 567.00 g/mol. Its IUPAC name is 2-butyloctyl 10-[3-(dimethylamino)propylamino]nonadecanoate.
| Compound Name | 2-butyloctyl 10-[3-(dimethylamino)propylamino]nonadecanoate |
|---|---|
| PubChem CID | 171658653 |
| Molecular Formula | C36H74N2O2 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.58 |
| IUPAC Name | 2-butyloctyl 10-[3-(dimethylamino)propylamino]nonadecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)NCCCN(C)C |
| InChI | InChI=1S/C36H74N2O2/c1-6-9-12-14-15-18-22-28-35(37-31-25-32-38(4)5)29-23-19-16-17-20-24-30-36(39)40-33-34(26-11-8-3)27-21-13-10-7-2/h34-35,37H,6-33H2,1-5H3 |
| InChIKey | LRAPLCTZGPXYJS-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|