C33H68N2O2 — CID 169107676
2-hexyldecyl 3-[3-(dimethylamino)propylamino]dodecanoate (PubChem CID 169107676) has the molecular formula C33H68N2O2 and a molecular weight of 524.92 g/mol. Its IUPAC name is 2-hexyldecyl 3-[3-(dimethylamino)propylamino]dodecanoate.
| Compound Name | 2-hexyldecyl 3-[3-(dimethylamino)propylamino]dodecanoate |
|---|---|
| PubChem CID | 169107676 |
| Molecular Formula | C33H68N2O2 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.53 |
| IUPAC Name | 2-hexyldecyl 3-[3-(dimethylamino)propylamino]dodecanoate |
| SMILES | CCCCCCCCCC(CC(=O)OCC(CCCCCC)CCCCCCCC)NCCCN(C)C |
| InChI | InChI=1S/C33H68N2O2/c1-6-9-12-15-17-19-22-26-32(34-27-23-28-35(4)5)29-33(36)37-30-31(24-20-14-11-8-3)25-21-18-16-13-10-7-2/h31-32,34H,6-30H2,1-5H3 |
| InChIKey | NRVKHLGXOMOYKU-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|