C52H104N2O8 — CID 177227093
[2-[3-(dimethylamino)propylamino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate (PubChem CID 177227093) has the molecular formula C52H104N2O8 and a molecular weight of 885.41 g/mol. Its IUPAC name is [2-[3-(dimethylamino)propylamino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate.
| Compound Name | [2-[3-(dimethylamino)propylamino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate |
|---|---|
| PubChem CID | 177227093 |
| Molecular Formula | C52H104N2O8 |
| Molecular Weight | 885.41 g/mol |
| Exact Mass | 884.78 |
| IUPAC Name | [2-[3-(dimethylamino)propylamino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate |
| SMILES | CCCCCCCCOC(CCCCC(=O)OCC(COC(=O)CCCCC(OCCCCCCCC)OCCCCCCCC)NCCCN(C)C)OCCCCCCCC |
| InChI | InChI=1S/C52H104N2O8/c1-7-11-15-19-23-31-42-57-51(58-43-32-24-20-16-12-8-2)38-29-27-36-49(55)61-46-48(53-40-35-41-54(5)6)47-62-50(56)37-28-30-39-52(59-44-33-25-21-17-13-9-3)60-45-34-26-22-18-14-10-4/h48,51-53H,7-47H2,1-6H3 |
| InChIKey | ZVMWVPWGVUUUDL-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.41 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|