C54H107N3O7 — CID 177227114
[3-(6,6-dioctoxyhexanoyloxy)-2-(3-pyrrolidin-1-ylpropylamino)propyl] 6-octoxy-6-(octylamino)hexanoate (PubChem CID 177227114) has the molecular formula C54H107N3O7 and a molecular weight of 910.46 g/mol. Its IUPAC name is [3-(6,6-dioctoxyhexanoyloxy)-2-(3-pyrrolidin-1-ylpropylamino)propyl] 6-octoxy-6-(octylamino)hexanoate.
| Compound Name | [3-(6,6-dioctoxyhexanoyloxy)-2-(3-pyrrolidin-1-ylpropylamino)propyl] 6-octoxy-6-(octylamino)hexanoate |
|---|---|
| PubChem CID | 177227114 |
| Molecular Formula | C54H107N3O7 |
| Molecular Weight | 910.46 g/mol |
| Exact Mass | 909.81 |
| IUPAC Name | [3-(6,6-dioctoxyhexanoyloxy)-2-(3-pyrrolidin-1-ylpropylamino)propyl] 6-octoxy-6-(octylamino)hexanoate |
| SMILES | CCCCCCCCNC(CCCCC(=O)OCC(COC(=O)CCCCC(OCCCCCCCC)OCCCCCCCC)NCCCN1CCCC1)OCCCCCCCC |
| InChI | InChI=1S/C54H107N3O7/c1-5-9-13-17-21-29-40-56-51(60-45-32-22-18-14-10-6-2)36-25-26-37-52(58)63-48-50(55-41-35-44-57-42-30-31-43-57)49-64-53(59)38-27-28-39-54(61-46-33-23-19-15-11-7-3)62-47-34-24-20-16-12-8-4/h50-51,54-56H,5-49H2,1-4H3 |
| InChIKey | ZVORWSGNDXAOHE-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.46 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|