C46H88N2O8 — CID 170657145
1-O-[2-[3-(dimethylamino)propylamino]-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate (PubChem CID 170657145) has the molecular formula C46H88N2O8 and a molecular weight of 797.22 g/mol. Its IUPAC name is 1-O-[2-[3-(dimethylamino)propylamino]-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate.
| Compound Name | 1-O-[2-[3-(dimethylamino)propylamino]-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate |
|---|---|
| PubChem CID | 170657145 |
| Molecular Formula | C46H88N2O8 |
| Molecular Weight | 797.22 g/mol |
| Exact Mass | 796.65 |
| IUPAC Name | 1-O-[2-[3-(dimethylamino)propylamino]-3-[8-oxo-8-[(3S)-undecan-3-yl]oxyoctanoyl]oxypropyl] 8-O-[(3S)-undecan-3-yl] octanedioate |
| SMILES | CCCCCCCC[C@H](CC)OC(=O)CCCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)O[C@@H](CC)CCCCCCCC)NCCCN(C)C |
| InChI | InChI=1S/C46H88N2O8/c1-7-11-13-15-17-23-30-41(9-3)55-45(51)34-27-21-19-25-32-43(49)53-38-40(47-36-29-37-48(5)6)39-54-44(50)33-26-20-22-28-35-46(52)56-42(10-4)31-24-18-16-14-12-8-2/h40-42,47H,7-39H2,1-6H3/t41-,42-/m0/s1 |
| InChIKey | IPEJMSIERJTVNM-COCZKOEFSA-N |
| XLogP | 10.81 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.22 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|