C66H128N2O11 — CID 177227040
[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate (PubChem CID 177227040) has the molecular formula C66H128N2O11 and a molecular weight of 1125.75 g/mol. Its IUPAC name is [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate.
| Compound Name | [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate |
|---|---|
| PubChem CID | 177227040 |
| Molecular Formula | C66H128N2O11 |
| Molecular Weight | 1125.75 g/mol |
| Exact Mass | 1124.95 |
| IUPAC Name | [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-dioctoxyhexanoyloxy)propyl] 6,6-dioctoxyhexanoate |
| SMILES | CCCCCCCCOC(CCCCC(=O)OCC(COC(=O)CCCCC(OCCCCCCCC)OCCCCCCCC)N(CCCN(C)C)C(=O)CCC(=O)OC(CCC)CCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C66H128N2O11/c1-9-15-20-25-29-38-53-73-65(74-54-39-30-26-21-16-10-2)47-36-34-45-62(70)77-57-59(68(52-42-51-67(7)8)61(69)49-50-64(72)79-60(43-14-6)44-33-24-19-13-5)58-78-63(71)46-35-37-48-66(75-55-40-31-27-22-17-11-3)76-56-41-32-28-23-18-12-4/h59-60,65-66H,9-58H2,1-8H3 |
| InChIKey | CDGRQAWHTOCKEE-UHFFFAOYSA-N |
| XLogP | 16.97 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 62 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.75 |
| LogP ≤ 5 | 16.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|