C66H112N2O11S — CID 177227112
[3-[6,6-bis(oct-3-ynoxy)hexanoyloxy]-2-[(3-decan-4-yloxy-3-oxopropyl)sulfanylcarbonyl-[3-(dimethylamino)propyl]amino]propyl] 6,6-bis(oct-3-ynoxy)hexanoate (PubChem CID 177227112) has the molecular formula C66H112N2O11S and a molecular weight of 1141.69 g/mol. Its IUPAC name is [3-[6,6-bis(oct-3-ynoxy)hexanoyloxy]-2-[(3-decan-4-yloxy-3-oxopropyl)sulfanylcarbonyl-[3-(dimethylamino)propyl]amino]propyl] 6,6-bis(oct-3-ynoxy)hexanoate.
| Compound Name | [3-[6,6-bis(oct-3-ynoxy)hexanoyloxy]-2-[(3-decan-4-yloxy-3-oxopropyl)sulfanylcarbonyl-[3-(dimethylamino)propyl]amino]propyl] 6,6-bis(oct-3-ynoxy)hexanoate |
|---|---|
| PubChem CID | 177227112 |
| Molecular Formula | C66H112N2O11S |
| Molecular Weight | 1141.69 g/mol |
| Exact Mass | 1140.80 |
| IUPAC Name | [3-[6,6-bis(oct-3-ynoxy)hexanoyloxy]-2-[(3-decan-4-yloxy-3-oxopropyl)sulfanylcarbonyl-[3-(dimethylamino)propyl]amino]propyl] 6,6-bis(oct-3-ynoxy)hexanoate |
| SMILES | CCCCC#CCCOC(CCCCC(=O)OCC(COC(=O)CCCCC(OCCC#CCCCC)OCCC#CCCCC)N(CCCN(C)C)C(=O)SCCC(=O)OC(CCC)CCCCCC)OCCC#CCCCC |
| InChI | InChI=1S/C66H112N2O11S/c1-9-15-20-25-29-38-52-73-64(74-53-39-30-26-21-16-10-2)47-36-34-45-61(69)77-57-59(68(51-42-50-67(7)8)66(72)80-56-49-63(71)79-60(43-14-6)44-33-24-19-13-5)58-78-62(70)46-35-37-48-65(75-54-40-31-27-22-17-11-3)76-55-41-32-28-23-18-12-4/h59-60,64-65H,9-24,33-58H2,1-8H3 |
| InChIKey | GEZBFGOUEOVCPB-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1141.69 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|