C64H120N2O11 — CID 176802532
[4-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[5-(dimethylamino)pentyl]amino]-3-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate (PubChem CID 176802532) has the molecular formula C64H120N2O11 and a molecular weight of 1093.67 g/mol. Its IUPAC name is [4-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[5-(dimethylamino)pentyl]amino]-3-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate.
| Compound Name | [4-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[5-(dimethylamino)pentyl]amino]-3-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 176802532 |
| Molecular Formula | C64H120N2O11 |
| Molecular Weight | 1093.67 g/mol |
| Exact Mass | 1092.89 |
| IUPAC Name | [4-[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[5-(dimethylamino)pentyl]amino]-3-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCC(=O)OCC(COC(=O)CCCOC(=O)C(CCCCCC)CCCCCCCC)N(CCCCCN(C)C)C(=O)CCC(=O)OC(CCC)CCCCCC |
| InChI | InChI=1S/C64H120N2O11/c1-9-15-20-25-27-32-42-55(40-30-22-17-11-3)63(71)73-51-37-45-60(68)75-53-57(54-76-61(69)46-38-52-74-64(72)56(41-31-23-18-12-4)43-33-28-26-21-16-10-2)66(50-36-29-35-49-65(7)8)59(67)47-48-62(70)77-58(39-14-6)44-34-24-19-13-5/h55-58H,9-54H2,1-8H3 |
| InChIKey | DUGXRLRDAYKJGT-UHFFFAOYSA-N |
| XLogP | 15.79 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.67 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|