C60H114N2O9 — CID 177227154
[2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-diheptoxyhexanoyloxy)propyl] (Z)-octadec-9-enoate (PubChem CID 177227154) has the molecular formula C60H114N2O9 and a molecular weight of 1007.58 g/mol. Its IUPAC name is [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-diheptoxyhexanoyloxy)propyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-diheptoxyhexanoyloxy)propyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 177227154 |
| Molecular Formula | C60H114N2O9 |
| Molecular Weight | 1007.58 g/mol |
| Exact Mass | 1006.85 |
| IUPAC Name | [2-[(4-decan-4-yloxy-4-oxobutanoyl)-[3-(dimethylamino)propyl]amino]-3-(6,6-diheptoxyhexanoyloxy)propyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCC(OCCCCCCC)OCCCCCCC)N(CCCN(C)C)C(=O)CCC(=O)OC(CCC)CCCCCC |
| InChI | InChI=1S/C60H114N2O9/c1-8-13-17-21-22-23-24-25-26-27-28-29-30-31-35-43-57(64)69-52-54(62(49-40-48-61(6)7)56(63)46-47-59(66)71-55(41-12-5)42-34-20-16-11-4)53-70-58(65)44-36-37-45-60(67-50-38-32-18-14-9-2)68-51-39-33-19-15-10-3/h25-26,54-55,60H,8-24,27-53H2,1-7H3/b26-25- |
| InChIKey | RBIAMEQYLUCBJO-QPLCGJKRSA-N |
| XLogP | 15.58 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.58 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|