About bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate
bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate (PubChem CID 170242558) has the molecular formula C56H111NO7
and a molecular weight of 910.50 g/mol. Its IUPAC name is bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate.
Molecular Properties
| Compound Name | bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate |
| PubChem CID | 170242558 |
| Molecular Formula | C56H111NO7 |
| Molecular Weight | 910.50 g/mol |
| Exact Mass | 909.84 |
| IUPAC Name | bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)NCCCOCCOCCOCCCC |
| InChI | InChI=1S/C56H111NO7/c1-6-11-16-20-22-28-37-52(35-26-18-13-8-3)50-63-55(58)41-32-24-30-39-54(57-43-34-45-61-47-49-62-48-46-60-44-15-10-5)40-31-25-33-42-56(59)64-51-53(36-27-19-14-9-4)38-29-23-21-17-12-7-2/h52-54,57H,6-51H2,1-5H3 |
| InChIKey | AXMNEEKKXSKCAV-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 910.50 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate?
The IUPAC name of bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate (CID 170242558) is bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate.
What is the SMILES notation for bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate?
The canonical SMILES for bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate is CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)NCCCOCCOCCOCCCC.
What is the InChIKey of bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate?
The InChIKey is AXMNEEKKXSKCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H111NO7/c1-6-11-16-20-22-28-37-52(35-26-18-13-8-3)50-63-55(58)41-32-24-30-39-54(57-43-34-45-61-47-49-62-48-46-60-44-15-10-5)40-31-25-33-42-56(59)64-51-53(36-27-19-14-9-4)38-29-23-21-17-12-7-2/h52-54,57H,6-51H2,1-5H3.
What are the key properties of bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate?
bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate has a molecular weight of 910.50 g/mol, XLogP of 15.85, 54 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hexyldecyl) 7-[3-[2-(2-butoxyethoxy)ethoxy]propylamino]tridecanedioate is sourced from PubChem (CID 170242558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).