About bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate
bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate (PubChem CID 146639394) has the molecular formula C48H95NO5
and a molecular weight of 766.29 g/mol. Its IUPAC name is bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate.
Molecular Properties
| Compound Name | bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate |
| PubChem CID | 146639394 |
| Molecular Formula | C48H95NO5 |
| Molecular Weight | 766.29 g/mol |
| Exact Mass | 765.72 |
| IUPAC Name | bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)NCCCO |
| InChI | InChI=1S/C48H95NO5/c1-5-9-13-17-19-25-34-44(32-23-15-11-7-3)42-53-47(51)38-29-21-27-36-46(49-40-31-41-50)37-28-22-30-39-48(52)54-43-45(33-24-16-12-8-4)35-26-20-18-14-10-6-2/h44-46,49-50H,5-43H2,1-4H3 |
| InChIKey | GBWPUCKHFJZIRE-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 766.29 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate?
The IUPAC name of bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate (CID 146639394) is bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate.
What is the SMILES notation for bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate?
The canonical SMILES for bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate is CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)NCCCO.
What is the InChIKey of bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate?
The InChIKey is GBWPUCKHFJZIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H95NO5/c1-5-9-13-17-19-25-34-44(32-23-15-11-7-3)42-53-47(51)38-29-21-27-36-46(49-40-31-41-50)37-28-22-30-39-48(52)54-43-45(33-24-16-12-8-4)35-26-20-18-14-10-6-2/h44-46,49-50H,5-43H2,1-4H3.
What are the key properties of bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate?
bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate has a molecular weight of 766.29 g/mol, XLogP of 13.99, 44 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hexyldecyl) 7-(3-hydroxypropylamino)tridecanedioate is sourced from PubChem (CID 146639394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).