C50H102N2O5 — CID 171658683
2-butyloctyl formate;2-butyloctyl 10-[3-[2-hydroxyethyl(methyl)amino]propylamino]nonadecanoate (PubChem CID 171658683) has the molecular formula C50H102N2O5 and a molecular weight of 811.37 g/mol. Its IUPAC name is 2-butyloctyl formate;2-butyloctyl 10-[3-[2-hydroxyethyl(methyl)amino]propylamino]nonadecanoate.
| Compound Name | 2-butyloctyl formate;2-butyloctyl 10-[3-[2-hydroxyethyl(methyl)amino]propylamino]nonadecanoate |
|---|---|
| PubChem CID | 171658683 |
| Molecular Formula | C50H102N2O5 |
| Molecular Weight | 811.37 g/mol |
| Exact Mass | 810.78 |
| IUPAC Name | 2-butyloctyl formate;2-butyloctyl 10-[3-[2-hydroxyethyl(methyl)amino]propylamino]nonadecanoate |
| SMILES | CCCCCCC(CCCC)COC=O.CCCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)NCCCN(C)CCO |
| InChI | InChI=1S/C37H76N2O3.C13H26O2/c1-5-8-11-13-14-17-21-27-36(38-30-24-31-39(4)32-33-40)28-22-18-15-16-19-23-29-37(41)42-34-35(25-10-7-3)26-20-12-9-6-2;1-3-5-7-8-10-13(9-6-4-2)11-15-12-14/h35-36,38,40H,5-34H2,1-4H3;12-13H,3-11H2,1-2H3 |
| InChIKey | ALOFJWOAJPLHOE-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.37 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|