C67H138N4O8S2 — CID 175930984
3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoic acid;methyl 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoate (PubChem CID 175930984) has the molecular formula C67H138N4O8S2 and a molecular weight of 1191.99 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoic acid;methyl 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoate.
| Compound Name | 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoic acid;methyl 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoate |
|---|---|
| PubChem CID | 175930984 |
| Molecular Formula | C67H138N4O8S2 |
| Molecular Weight | 1191.99 g/mol |
| Exact Mass | 1191.00 |
| IUPAC Name | 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoic acid;methyl 3-[3-(dimethylamino)propyl-(2-hexyldecylsulfonyl)amino]dodecanoate |
| SMILES | CCCCCCCCCC(CC(=O)O)N(CCCN(C)C)S(=O)(=O)CC(CCCCCC)CCCCCCCC.CCCCCCCCCC(CC(=O)OC)N(CCCN(C)C)S(=O)(=O)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C34H70N2O4S.C33H68N2O4S/c1-7-10-13-16-18-20-23-27-33(30-34(37)40-6)36(29-24-28-35(4)5)41(38,39)31-32(25-21-15-12-9-3)26-22-19-17-14-11-8-2;1-6-9-12-15-17-19-22-26-32(29-33(36)37)35(28-23-27-34(4)5)40(38,39)30-31(24-20-14-11-8-3)25-21-18-16-13-10-7-2/h32-33H,7-31H2,1-6H3;31-32H,6-30H2,1-5H3,(H,36,37) |
| InChIKey | SKLRKRGBBIKHJI-UHFFFAOYSA-N |
| XLogP | 17.87 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 60 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.99 |
| LogP ≤ 5 | 17.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|