C44H92N4O6S — CID 175930998
methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-octylsulfonylamino]dodecanoate (PubChem CID 175930998) has the molecular formula C44H92N4O6S and a molecular weight of 805.31 g/mol. Its IUPAC name is methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-octylsulfonylamino]dodecanoate.
| Compound Name | methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-octylsulfonylamino]dodecanoate |
|---|---|
| PubChem CID | 175930998 |
| Molecular Formula | C44H92N4O6S |
| Molecular Weight | 805.31 g/mol |
| Exact Mass | 804.67 |
| IUPAC Name | methyl 3-[3-(dimethylamino)propylamino]dodecanoate;methyl 3-[3-(dimethylamino)propyl-octylsulfonylamino]dodecanoate |
| SMILES | CCCCCCCCCC(CC(=O)OC)N(CCCN(C)C)S(=O)(=O)CCCCCCCC.CCCCCCCCCC(CC(=O)OC)NCCCN(C)C |
| InChI | InChI=1S/C26H54N2O4S.C18H38N2O2/c1-6-8-10-12-14-15-17-20-25(24-26(29)32-5)28(22-19-21-27(3)4)33(30,31)23-18-16-13-11-9-7-2;1-5-6-7-8-9-10-11-13-17(16-18(21)22-4)19-14-12-15-20(2)3/h25H,6-24H2,1-5H3;17,19H,5-16H2,1-4H3 |
| InChIKey | NHGUHMYYYFIJCB-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.31 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|