C41H73FN2O4 — CID 169107811
3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecyl 2-fluoro-2-hexyldecanoate (PubChem CID 169107811) has the molecular formula C41H73FN2O4 and a molecular weight of 677.04 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecyl 2-fluoro-2-hexyldecanoate.
| Compound Name | 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecyl 2-fluoro-2-hexyldecanoate |
|---|---|
| PubChem CID | 169107811 |
| Molecular Formula | C41H73FN2O4 |
| Molecular Weight | 677.04 g/mol |
| Exact Mass | 676.56 |
| IUPAC Name | 3-[3-(dimethylamino)propyl-phenylmethoxycarbonylamino]dodecyl 2-fluoro-2-hexyldecanoate |
| SMILES | CCCCCCCCCC(CCOC(=O)C(F)(CCCCCC)CCCCCCCC)N(CCCN(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H73FN2O4/c1-6-9-12-15-17-18-23-29-38(44(34-26-33-43(4)5)40(46)48-36-37-27-21-20-22-28-37)30-35-47-39(45)41(42,31-24-14-11-8-3)32-25-19-16-13-10-7-2/h20-22,27-28,38H,6-19,23-26,29-36H2,1-5H3 |
| InChIKey | BUDODZCWMFNKFM-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.04 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|