C32H52N2O8 — CID 70596769
dimethyl 2-[(3-hydroxy-3-methylnonyl)-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]amino]nonanedioate (PubChem CID 70596769) has the molecular formula C32H52N2O8 and a molecular weight of 592.77 g/mol. Its IUPAC name is dimethyl 2-[(3-hydroxy-3-methylnonyl)-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]amino]nonanedioate.
| Compound Name | dimethyl 2-[(3-hydroxy-3-methylnonyl)-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]amino]nonanedioate |
|---|---|
| PubChem CID | 70596769 |
| Molecular Formula | C32H52N2O8 |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.37 |
| IUPAC Name | dimethyl 2-[(3-hydroxy-3-methylnonyl)-[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]amino]nonanedioate |
| SMILES | CCCCCCC(C)(O)CCN(C(=O)CN(C)C(=O)OCc1ccccc1)C(CCCCCCC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C32H52N2O8/c1-6-7-8-16-21-32(2,39)22-23-34(27(30(37)41-5)19-14-9-10-15-20-29(36)40-4)28(35)24-33(3)31(38)42-25-26-17-12-11-13-18-26/h11-13,17-18,27,39H,6-10,14-16,19-25H2,1-5H3 |
| InChIKey | INULQEZQGYTDAP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|