C25H41NO5 — CID 20531207
diethyl 2-[(3-hydroxy-3-methyl-5-phenylpentyl)amino]nonanedioate (PubChem CID 20531207) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is diethyl 2-[(3-hydroxy-3-methyl-5-phenylpentyl)amino]nonanedioate.
| Compound Name | diethyl 2-[(3-hydroxy-3-methyl-5-phenylpentyl)amino]nonanedioate |
|---|---|
| PubChem CID | 20531207 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | diethyl 2-[(3-hydroxy-3-methyl-5-phenylpentyl)amino]nonanedioate |
| SMILES | CCOC(=O)CCCCCCC(NCCC(C)(O)CCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C25H41NO5/c1-4-30-23(27)16-12-7-6-11-15-22(24(28)31-5-2)26-20-19-25(3,29)18-17-21-13-9-8-10-14-21/h8-10,13-14,22,26,29H,4-7,11-12,15-20H2,1-3H3 |
| InChIKey | UGSKUGISRIXBGK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|