C26H50F2O2S — CID 170089677
heptadecan-9-yl 2,2-difluoro-8-methylsulfanyloctanoate (PubChem CID 170089677) has the molecular formula C26H50F2O2S and a molecular weight of 464.75 g/mol. Its IUPAC name is heptadecan-9-yl 2,2-difluoro-8-methylsulfanyloctanoate.
| Compound Name | heptadecan-9-yl 2,2-difluoro-8-methylsulfanyloctanoate |
|---|---|
| PubChem CID | 170089677 |
| Molecular Formula | C26H50F2O2S |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | heptadecan-9-yl 2,2-difluoro-8-methylsulfanyloctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)C(F)(F)CCCCCCSC |
| InChI | InChI=1S/C26H50F2O2S/c1-4-6-8-10-12-16-20-24(21-17-13-11-9-7-5-2)30-25(29)26(27,28)22-18-14-15-19-23-31-3/h24H,4-23H2,1-3H3 |
| InChIKey | ALYHEQBFNLEKFE-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|