C59H114N2O7S — CID 170771321
octadecan-9-yl 8-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pentanoyl-(6-octadecan-9-yloxy-6-oxohexyl)amino]octanoate (PubChem CID 170771321) has the molecular formula C59H114N2O7S and a molecular weight of 995.63 g/mol. Its IUPAC name is octadecan-9-yl 8-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pentanoyl-(6-octadecan-9-yloxy-6-oxohexyl)amino]octanoate.
| Compound Name | octadecan-9-yl 8-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pentanoyl-(6-octadecan-9-yloxy-6-oxohexyl)amino]octanoate |
|---|---|
| PubChem CID | 170771321 |
| Molecular Formula | C59H114N2O7S |
| Molecular Weight | 995.63 g/mol |
| Exact Mass | 994.83 |
| IUPAC Name | octadecan-9-yl 8-[5-(1,1-dioxo-1,4-thiazinan-4-yl)pentanoyl-(6-octadecan-9-yloxy-6-oxohexyl)amino]octanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCC(=O)OC(CCCCCCCC)CCCCCCCCC)C(=O)CCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C59H114N2O7S/c1-5-9-13-17-21-26-33-43-55(41-31-24-19-15-11-7-3)67-58(63)46-35-28-23-29-38-49-61(57(62)45-37-40-48-60-51-53-69(65,66)54-52-60)50-39-30-36-47-59(64)68-56(42-32-25-20-16-12-8-4)44-34-27-22-18-14-10-6-2/h55-56H,5-54H2,1-4H3 |
| InChIKey | XKQTWDHPJDKNTP-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.63 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|