C57H106N2O6 — CID 170618882
ethane;[2-[[2-ethylheptanoyl-[3-[2-hydroxyethyl(methyl)amino]propyl]amino]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170618882) has the molecular formula C57H106N2O6 and a molecular weight of 915.48 g/mol. Its IUPAC name is ethane;[2-[[2-ethylheptanoyl-[3-[2-hydroxyethyl(methyl)amino]propyl]amino]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | ethane;[2-[[2-ethylheptanoyl-[3-[2-hydroxyethyl(methyl)amino]propyl]amino]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170618882 |
| Molecular Formula | C57H106N2O6 |
| Molecular Weight | 915.48 g/mol |
| Exact Mass | 914.81 |
| IUPAC Name | ethane;[2-[[2-ethylheptanoyl-[3-[2-hydroxyethyl(methyl)amino]propyl]amino]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC.CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CN(CCCN(C)CCO)C(=O)C(CC)CCCCC |
| InChI | InChI=1S/C55H100N2O6.C2H6/c1-6-10-13-15-17-19-21-23-25-27-29-31-33-35-38-42-53(59)62-49-51(48-57(45-40-44-56(5)46-47-58)55(61)52(9-4)41-37-12-8-3)50-63-54(60)43-39-36-34-32-30-28-26-24-22-20-18-16-14-11-7-2;1-2/h17-20,23-26,51-52,58H,6-16,21-22,27-50H2,1-5H3;1-2H3/b19-17-,20-18-,25-23-,26-24-; |
| InChIKey | BJWLKPQKJNBWGN-FTJUCTAHSA-N |
| XLogP | 15.09 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.48 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|