C60H107NO8 — CID 165008100
[2-[[3-[4-[ethyl(methyl)amino]butanoyloxy]-2,2-dimethylundecanoyl]oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 165008100) has the molecular formula C60H107NO8 and a molecular weight of 970.51 g/mol. Its IUPAC name is [2-[[3-[4-[ethyl(methyl)amino]butanoyloxy]-2,2-dimethylundecanoyl]oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[[3-[4-[ethyl(methyl)amino]butanoyloxy]-2,2-dimethylundecanoyl]oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165008100 |
| Molecular Formula | C60H107NO8 |
| Molecular Weight | 970.51 g/mol |
| Exact Mass | 969.80 |
| IUPAC Name | [2-[[3-[4-[ethyl(methyl)amino]butanoyloxy]-2,2-dimethylundecanoyl]oxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)C(C)(C)C(CCCCCCCC)OC(=O)CCCN(C)CC |
| InChI | InChI=1S/C60H107NO8/c1-8-12-15-18-21-23-25-27-29-31-33-35-37-40-43-47-56(62)66-51-54(52-67-57(63)48-44-41-38-36-34-32-30-28-26-24-22-19-16-13-9-2)53-68-59(65)60(5,6)55(46-42-39-20-17-14-10-3)69-58(64)49-45-50-61(7)11-4/h21-24,27-30,54-55H,8-20,25-26,31-53H2,1-7H3/b23-21-,24-22-,29-27-,30-28- |
| InChIKey | LWOCQDJEBPTQHB-WRGXGLASSA-N |
| XLogP | 16.28 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.51 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|