C28H52N2O5 — CID 144532107
[4-(dimethylamino)butanoyl-(2-formyloxyethyl)amino]methyl (Z)-octadec-9-enoate (PubChem CID 144532107) has the molecular formula C28H52N2O5 and a molecular weight of 496.73 g/mol. Its IUPAC name is [4-(dimethylamino)butanoyl-(2-formyloxyethyl)amino]methyl (Z)-octadec-9-enoate.
| Compound Name | [4-(dimethylamino)butanoyl-(2-formyloxyethyl)amino]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 144532107 |
| Molecular Formula | C28H52N2O5 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | [4-(dimethylamino)butanoyl-(2-formyloxyethyl)amino]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCN(CCOC=O)C(=O)CCCN(C)C |
| InChI | InChI=1S/C28H52N2O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-28(33)35-25-30(23-24-34-26-31)27(32)20-19-22-29(2)3/h11-12,26H,4-10,13-25H2,1-3H3/b12-11- |
| InChIKey | SMBPHRWVADMXPV-QXMHVHEDSA-N |
| XLogP | 5.87 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|