C26H48N2O5 — CID 138658365
[3-(dimethylamino)propanoyl-(formyloxymethyl)amino]methyl (Z)-octadec-9-enoate (PubChem CID 138658365) has the molecular formula C26H48N2O5 and a molecular weight of 468.68 g/mol. Its IUPAC name is [3-(dimethylamino)propanoyl-(formyloxymethyl)amino]methyl (Z)-octadec-9-enoate.
| Compound Name | [3-(dimethylamino)propanoyl-(formyloxymethyl)amino]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 138658365 |
| Molecular Formula | C26H48N2O5 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | [3-(dimethylamino)propanoyl-(formyloxymethyl)amino]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCN(COC=O)C(=O)CCN(C)C |
| InChI | InChI=1S/C26H48N2O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(31)33-23-28(22-32-24-29)25(30)20-21-27(2)3/h11-12,24H,4-10,13-23H2,1-3H3/b12-11- |
| InChIKey | NWGHMWNDJVTOHM-QXMHVHEDSA-N |
| XLogP | 5.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|