C29H50N2O6 — CID 155132355
2-[2-formyloxyethyl-[2-[3-(hydroxymethyl)azetidin-1-yl]acetyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 155132355) has the molecular formula C29H50N2O6 and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-[2-formyloxyethyl-[2-[3-(hydroxymethyl)azetidin-1-yl]acetyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[2-formyloxyethyl-[2-[3-(hydroxymethyl)azetidin-1-yl]acetyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 155132355 |
| Molecular Formula | C29H50N2O6 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | 2-[2-formyloxyethyl-[2-[3-(hydroxymethyl)azetidin-1-yl]acetyl]amino]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCN(CCOC=O)C(=O)CN1CC(CO)C1 |
| InChI | InChI=1S/C29H50N2O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-29(35)37-21-19-31(18-20-36-26-33)28(34)24-30-22-27(23-30)25-32/h6-7,9-10,26-27,32H,2-5,8,11-25H2,1H3/b7-6-,10-9- |
| InChIKey | HATJNQWHZOOGHD-HZJYTTRNSA-N |
| XLogP | 4.27 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|