C57H108N4O8 — CID 100995841
[2,2-bis[3-[3-(dimethylamino)propylamino]propanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 100995841) has the molecular formula C57H108N4O8 and a molecular weight of 977.51 g/mol. Its IUPAC name is [2,2-bis[3-[3-(dimethylamino)propylamino]propanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2,2-bis[3-[3-(dimethylamino)propylamino]propanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 100995841 |
| Molecular Formula | C57H108N4O8 |
| Molecular Weight | 977.51 g/mol |
| Exact Mass | 976.82 |
| IUPAC Name | [2,2-bis[3-[3-(dimethylamino)propylamino]propanoyloxymethyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)(COC(=O)CCNCCCN(C)C)COC(=O)CCNCCCN(C)C |
| InChI | InChI=1S/C57H108N4O8/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-53(62)66-49-57(51-68-55(64)41-45-58-43-37-47-60(3)4,52-69-56(65)42-46-59-44-38-48-61(5)6)50-67-54(63)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,58-59H,7-20,25-52H2,1-6H3/b23-21-,24-22- |
| InChIKey | UFWGZOJLNGJMRA-SXAUZNKPSA-N |
| XLogP | 12.08 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.51 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|