About 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate
3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate (PubChem CID 123167253) has the molecular formula C42H79NO4
and a molecular weight of 662.10 g/mol. Its IUPAC name is 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate.
Molecular Properties
| Compound Name | 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate |
| PubChem CID | 123167253 |
| Molecular Formula | C42H79NO4 |
| Molecular Weight | 662.10 g/mol |
| Exact Mass | 661.60 |
| IUPAC Name | 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCCNCCCOC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C42H79NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-41(44)46-39-33-37-43-38-34-40-47-42(45)36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,43H,3-16,21-40H2,1-2H3 |
| InChIKey | DKDJVTGLONVFOC-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.10 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate?
The IUPAC name of 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate (CID 123167253) is 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate.
What is the SMILES notation for 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate?
The canonical SMILES for 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OCCCNCCCOC(=O)CCCCCCCC=CCCCCCCCC.
What is the InChIKey of 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate?
The InChIKey is DKDJVTGLONVFOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H79NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-41(44)46-39-33-37-43-38-34-40-47-42(45)36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,43H,3-16,21-40H2,1-2H3.
What are the key properties of 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate?
3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate has a molecular weight of 662.10 g/mol, XLogP of 12.52, 38 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-octadec-9-enoyloxypropylamino)propyl octadec-9-enoate is sourced from PubChem (CID 123167253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).