C49H89NO6 — CID 137473902
[2-[(dimethylamino)methyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate (PubChem CID 137473902) has the molecular formula C49H89NO6 and a molecular weight of 788.25 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate.
| Compound Name | [2-[(dimethylamino)methyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 137473902 |
| Molecular Formula | C49H89NO6 |
| Molecular Weight | 788.25 g/mol |
| Exact Mass | 787.67 |
| IUPAC Name | [2-[(dimethylamino)methyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)(COC(=O)CCCCCCC/C=C\CCCC)CN(C)C |
| InChI | InChI=1S/C49H89NO6/c1-6-9-12-15-18-21-24-27-30-33-36-39-46(51)54-43-49(42-50(4)5,44-55-47(52)40-37-34-31-28-25-22-19-16-13-10-7-2)45-56-48(53)41-38-35-32-29-26-23-20-17-14-11-8-3/h15-20H,6-14,21-45H2,1-5H3/b18-15-,19-16-,20-17- |
| InChIKey | ABCWAHXLLANOPD-QMJZYSMNSA-N |
| XLogP | 13.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.25 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|