C50H92NO6+ — CID 134205304
trimethyl-[3-[(Z)-tetradec-9-enoyl]oxy-2,2-bis[[(Z)-tetradec-9-enoyl]oxymethyl]propyl]azanium (PubChem CID 134205304) has the molecular formula C50H92NO6+ and a molecular weight of 803.29 g/mol. Its IUPAC name is trimethyl-[3-[(Z)-tetradec-9-enoyl]oxy-2,2-bis[[(Z)-tetradec-9-enoyl]oxymethyl]propyl]azanium.
| Compound Name | trimethyl-[3-[(Z)-tetradec-9-enoyl]oxy-2,2-bis[[(Z)-tetradec-9-enoyl]oxymethyl]propyl]azanium |
|---|---|
| PubChem CID | 134205304 |
| Molecular Formula | C50H92NO6+ |
| Molecular Weight | 803.29 g/mol |
| Exact Mass | 802.69 |
| IUPAC Name | trimethyl-[3-[(Z)-tetradec-9-enoyl]oxy-2,2-bis[[(Z)-tetradec-9-enoyl]oxymethyl]propyl]azanium |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCC)(COC(=O)CCCCCCC/C=C\CCCC)C[N+](C)(C)C |
| InChI | InChI=1S/C50H92NO6/c1-7-10-13-16-19-22-25-28-31-34-37-40-47(52)55-44-50(43-51(4,5)6,45-56-48(53)41-38-35-32-29-26-23-20-17-14-11-8-2)46-57-49(54)42-39-36-33-30-27-24-21-18-15-12-9-3/h16-21H,7-15,22-46H2,1-6H3/q+1/b19-16-,20-17-,21-18- |
| InChIKey | VMIQFGQCSQCPRW-JFJOQQEJSA-N |
| XLogP | 13.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.29 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|