C55H102ClNO6 — CID 134205318
[1,3-bis[[(Z)-hexadec-9-enoyl]oxy]-2-[[(Z)-hexadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium chloride (PubChem CID 134205318) has the molecular formula C55H102ClNO6 and a molecular weight of 908.87 g/mol. Its IUPAC name is [1,3-bis[[(Z)-hexadec-9-enoyl]oxy]-2-[[(Z)-hexadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium chloride.
| Compound Name | [1,3-bis[[(Z)-hexadec-9-enoyl]oxy]-2-[[(Z)-hexadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 134205318 |
| Molecular Formula | C55H102ClNO6 |
| Molecular Weight | 908.87 g/mol |
| Exact Mass | 907.74 |
| IUPAC Name | [1,3-bis[[(Z)-hexadec-9-enoyl]oxy]-2-[[(Z)-hexadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium chloride |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCC)(COC(=O)CCCCCCC/C=C\CCCCCC)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C55H102NO6.ClH/c1-7-10-13-16-19-22-25-28-31-34-37-40-43-46-52(57)60-49-55(56(4,5)6,50-61-53(58)47-44-41-38-35-32-29-26-23-20-17-14-11-8-2)51-62-54(59)48-45-42-39-36-33-30-27-24-21-18-15-12-9-3;/h22-27H,7-21,28-51H2,1-6H3;1H/q+1;/p-1/b25-22-,26-23-,27-24-; |
| InChIKey | CGDGAMVNHNCLBS-LXJPWSMRSA-M |
| XLogP | 12.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.87 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|