C44H82NO6+ — CID 146652672
[1-formyloxy-3-[(Z)-octadec-9-enoyl]oxy-2-[[(Z)-octadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium (PubChem CID 146652672) has the molecular formula C44H82NO6+ and a molecular weight of 721.14 g/mol. Its IUPAC name is [1-formyloxy-3-[(Z)-octadec-9-enoyl]oxy-2-[[(Z)-octadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium.
| Compound Name | [1-formyloxy-3-[(Z)-octadec-9-enoyl]oxy-2-[[(Z)-octadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 146652672 |
| Molecular Formula | C44H82NO6+ |
| Molecular Weight | 721.14 g/mol |
| Exact Mass | 720.61 |
| IUPAC Name | [1-formyloxy-3-[(Z)-octadec-9-enoyl]oxy-2-[[(Z)-octadec-9-enoyl]oxymethyl]propan-2-yl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC=O)(COC(=O)CCCCCCC/C=C\CCCCCCCC)[N+](C)(C)C |
| InChI | InChI=1S/C44H82NO6/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(47)50-39-44(38-49-41-46,45(3,4)5)40-51-43(48)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,41H,6-19,24-40H2,1-5H3/q+1/b22-20-,23-21- |
| InChIKey | FHRNQHIEHWEJRM-YEUCEMRASA-N |
| XLogP | 11.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.14 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|