C70H126NO9+ — CID 134226558
[1,3-bis[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]-2-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]methyl]propan-2-yl]-trimethylazanium (PubChem CID 134226558) has the molecular formula C70H126NO9+ and a molecular weight of 1125.78 g/mol. Its IUPAC name is [1,3-bis[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]-2-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]methyl]propan-2-yl]-trimethylazanium.
| Compound Name | [1,3-bis[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]-2-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]methyl]propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 134226558 |
| Molecular Formula | C70H126NO9+ |
| Molecular Weight | 1125.78 g/mol |
| Exact Mass | 1124.94 |
| IUPAC Name | [1,3-bis[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]-2-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]methyl]propan-2-yl]-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CCOCC(COCCC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)(COCCC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)[N+](C)(C)C |
| InChI | InChI=1S/C70H126NO9/c1-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-58-78-67(72)55-61-75-64-70(71(4,5)6,65-76-62-56-68(73)79-59-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-2)66-77-63-57-69(74)80-60-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-3/h19-24,28-33H,7-18,25-27,34-66H2,1-6H3/q+1/b22-19-,23-20-,24-21-,31-28-,32-29-,33-30- |
| InChIKey | JCOLFEHCAYKQMN-MOKVCOEPSA-N |
| XLogP | 18.72 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 61 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.78 |
| LogP ≤ 5 | 18.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|