C63H120ClNO4 — CID 134205144
[(Z)-4,4-bis[[(Z)-octadec-9-enoyl]oxymethyl]docos-13-enyl]-trimethylazanium chloride (PubChem CID 134205144) has the molecular formula C63H120ClNO4 and a molecular weight of 991.11 g/mol. Its IUPAC name is [(Z)-4,4-bis[[(Z)-octadec-9-enoyl]oxymethyl]docos-13-enyl]-trimethylazanium chloride.
| Compound Name | [(Z)-4,4-bis[[(Z)-octadec-9-enoyl]oxymethyl]docos-13-enyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 134205144 |
| Molecular Formula | C63H120ClNO4 |
| Molecular Weight | 991.11 g/mol |
| Exact Mass | 989.89 |
| IUPAC Name | [(Z)-4,4-bis[[(Z)-octadec-9-enoyl]oxymethyl]docos-13-enyl]-trimethylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCC[N+](C)(C)C)(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C63H120NO4.ClH/c1-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-56-63(57-53-58-64(4,5)6,59-67-61(65)54-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-2)60-68-62(66)55-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-3;/h28-33H,7-27,34-60H2,1-6H3;1H/q+1;/p-1/b31-28-,32-29-,33-30-; |
| InChIKey | XAIPBVUFOUMCCD-WRNPNSOXSA-M |
| XLogP | 17.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.11 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|