C40H73NO2 — CID 170127925
[(6E,8E,26Z,28E)-17-methyltetratriaconta-6,8,26,28-tetraen-17-yl] 3-(dimethylamino)propanoate (PubChem CID 170127925) has the molecular formula C40H73NO2 and a molecular weight of 600.03 g/mol. Its IUPAC name is [(6E,8E,26Z,28E)-17-methyltetratriaconta-6,8,26,28-tetraen-17-yl] 3-(dimethylamino)propanoate.
| Compound Name | [(6E,8E,26Z,28E)-17-methyltetratriaconta-6,8,26,28-tetraen-17-yl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 170127925 |
| Molecular Formula | C40H73NO2 |
| Molecular Weight | 600.03 g/mol |
| Exact Mass | 599.56 |
| IUPAC Name | [(6E,8E,26Z,28E)-17-methyltetratriaconta-6,8,26,28-tetraen-17-yl] 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C/C=C\CCCCCCCCC(C)(CCCCCCC/C=C/C=C/CCCCC)OC(=O)CCN(C)C |
| InChI | InChI=1S/C40H73NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-40(3,43-39(42)35-38-41(4)5)36-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-21H,6-13,22-38H2,1-5H3/b16-14+,17-15+,20-18-,21-19+ |
| InChIKey | BMSBZQRZKNEAPF-JBTQKASLSA-N |
| XLogP | 12.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.03 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|